CAS 2097773-49-2 is the registry number for Sodium 6-methylpyridine-2-sulfinate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Sodium 6-methylpyridine-2-sulfinate (CAS 2097773-49-2) is a chemical compound with the molecular formula C6H6NNaO2S and a molecular weight of 179.17 g/mol. IUPAC name: sodium 6-methylpyridine-2-sulfinate. InChIKey: HEJRAYQUVGSDGK-UHFFFAOYSA-M.
| Molecular formula | C6H6NNaO2S |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | sodium 6-methylpyridine-2-sulfinate |
| InChIKey | HEJRAYQUVGSDGK-UHFFFAOYSA-M |
| SMILES | CC1=NC(=CC=C1)S(=O)[O-].[Na+] |
Computed by PubChem (NCBI)