Products 100704-38-9

CAS 100704-38-9 appears in our catalog under these names: 4-Methanesulfonylthiophene-2-carboxylic acid, 95%, 4-Methanesulfonylthiophene-2-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.

4-methylsulfonylthiophene-2-carboxylic acid (CAS 100704-38-9) is a chemical compound with the molecular formula C6H6O4S2 and a molecular weight of 206.2 g/mol. IUPAC name: 4-methylsulfonylthiophene-2-carboxylic acid. InChIKey: YCQZXJWBSJMXJG-UHFFFAOYSA-N.

Identity
Molecular formulaC6H6O4S2
Molecular weight206.2 g/mol
IUPAC name4-methylsulfonylthiophene-2-carboxylic acid
InChIKeyYCQZXJWBSJMXJG-UHFFFAOYSA-N
SMILESCS(=O)(=O)C1=CSC(=C1)C(=O)O

Computed by PubChem (NCBI)