CAS 60166-82-7 is the registry number for 3-Methanesulfonylthiophene-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-methylsulfonylthiophene-2-carboxylic acid (CAS 60166-82-7) is a chemical compound with the molecular formula C6H6O4S2 and a molecular weight of 206.2 g/mol. IUPAC name: 3-methylsulfonylthiophene-2-carboxylic acid. InChIKey: PQXRSCJVSJHFCH-UHFFFAOYSA-N.
| Molecular formula | C6H6O4S2 |
|---|---|
| Molecular weight | 206.2 g/mol |
| IUPAC name | 3-methylsulfonylthiophene-2-carboxylic acid |
| InChIKey | PQXRSCJVSJHFCH-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(SC=C1)C(=O)O |
Computed by PubChem (NCBI)