Products 71154-33-1

CAS 71154-33-1 is the registry number for 2-Methanesulfonylthiophene-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-methylsulfonylthiophene-3-carboxylic acid (CAS 71154-33-1) is a chemical compound with the molecular formula C6H6O4S2 and a molecular weight of 206.2 g/mol. IUPAC name: 2-methylsulfonylthiophene-3-carboxylic acid. InChIKey: LTSDARSWFCHOEY-UHFFFAOYSA-N.

Identity
Molecular formulaC6H6O4S2
Molecular weight206.2 g/mol
IUPAC name2-methylsulfonylthiophene-3-carboxylic acid
InChIKeyLTSDARSWFCHOEY-UHFFFAOYSA-N
SMILESCS(=O)(=O)C1=C(C=CS1)C(=O)O

Computed by PubChem (NCBI)