CAS 1007213-16-2 appears in our catalog under these names: 4-(4-Bromo-3-chlorobenzoyl)morpholine, 95%, (4-Bromo-3-chlorophenyl)(morpholino)methanone, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g, 10g.
(4-bromo-3-chlorophenyl)-morpholin-4-ylmethanone (CAS 1007213-16-2) is a chemical compound with the molecular formula C11H11BrClNO2 and a molecular weight of 304.57 g/mol. IUPAC name: (4-bromo-3-chlorophenyl)-morpholin-4-ylmethanone. InChIKey: DIICLOPAHPMKQS-UHFFFAOYSA-N.
| Molecular formula | C11H11BrClNO2 |
|---|---|
| Molecular weight | 304.57 g/mol |
| IUPAC name | (4-bromo-3-chlorophenyl)-morpholin-4-ylmethanone |
| InChIKey | DIICLOPAHPMKQS-UHFFFAOYSA-N |
| SMILES | C1COCCN1C(=O)C2=CC(=C(C=C2)Br)Cl |
Computed by PubChem (NCBI)