CAS 1327122-76-8 appears in our catalog under these names: (3-Bromo-5-chloro-phenyl)-morpholin-4-yl-methanone, 95%, (3-Bromo-5-chlorophenyl)(morpholino)methanone, ≥95%, ≥95%, (3-Bromo-5-chlorophenyl)(morpholino)methanone. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g.
(3-bromo-5-chlorophenyl)-morpholin-4-ylmethanone (CAS 1327122-76-8) is a chemical compound with the molecular formula C11H11BrClNO2 and a molecular weight of 304.57 g/mol. IUPAC name: (3-bromo-5-chlorophenyl)-morpholin-4-ylmethanone. InChIKey: PQHHUCXZBNRYQZ-UHFFFAOYSA-N.
| Molecular formula | C11H11BrClNO2 |
|---|---|
| Molecular weight | 304.57 g/mol |
| IUPAC name | (3-bromo-5-chlorophenyl)-morpholin-4-ylmethanone |
| InChIKey | PQHHUCXZBNRYQZ-UHFFFAOYSA-N |
| SMILES | C1COCCN1C(=O)C2=CC(=CC(=C2)Br)Cl |
Computed by PubChem (NCBI)