CAS 701254-38-8 is the registry number for 1-Bromo-4-chloro-3-(morpholinocarbonyl)benzene, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g.
(5-bromo-2-chlorophenyl)-morpholin-4-ylmethanone (CAS 701254-38-8) is a chemical compound with the molecular formula C11H11BrClNO2 and a molecular weight of 304.57 g/mol. IUPAC name: (5-bromo-2-chlorophenyl)-morpholin-4-ylmethanone. InChIKey: MNVNAICUYQZULP-UHFFFAOYSA-N.
| Molecular formula | C11H11BrClNO2 |
|---|---|
| Molecular weight | 304.57 g/mol |
| IUPAC name | (5-bromo-2-chlorophenyl)-morpholin-4-ylmethanone |
| InChIKey | MNVNAICUYQZULP-UHFFFAOYSA-N |
| SMILES | C1COCCN1C(=O)C2=C(C=CC(=C2)Br)Cl |
Computed by PubChem (NCBI)