CAS 1007476-82-5 is the registry number for alpha-Ketobutyric Acid-d2 Sodium Salt. Offered by: TRC. Available pack sizes: 25mg.
Sodium 3,3-dideuterio-2-oxobutanoate (CAS 1007476-82-5) is a chemical compound with the molecular formula C4H5NaO3 and a molecular weight of 126.08 g/mol. IUPAC name: sodium 3,3-dideuterio-2-oxobutanoate. InChIKey: SUAMAHKUSIHRMR-IYPYQTRPSA-M.
| Molecular formula | C4H5NaO3 |
|---|---|
| Molecular weight | 126.08 g/mol |
| IUPAC name | sodium 3,3-dideuterio-2-oxobutanoate |
| InChIKey | SUAMAHKUSIHRMR-IYPYQTRPSA-M |
| SMILES | [2H]C([2H])(C)C(=O)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)