CAS 360769-17-1 appears in our catalog under these names: alpha-Ketobutyric Acid-13C4,d2 Sodium Salt, Sodium 2-oxobutanoate-13C4,d2. Offered by: TRC, MedChemExpress. Available pack sizes: 25mg, 1 mg.
Sodium 3,3-dideuterio-2-oxo(1,2,3,4-13C4)butanoate (CAS 360769-17-1) is a chemical compound with the molecular formula C4H5NaO3 and a molecular weight of 130.054 g/mol. IUPAC name: sodium 3,3-dideuterio-2-oxo(1,2,3,4-13C4)butanoate. InChIKey: SUAMAHKUSIHRMR-KQJMWJMRSA-M.
| Molecular formula | C4H5NaO3 |
|---|---|
| Molecular weight | 130.054 g/mol |
| IUPAC name | sodium 3,3-dideuterio-2-oxo(1,2,3,4-13C4)butanoate |
| InChIKey | SUAMAHKUSIHRMR-KQJMWJMRSA-M |
| SMILES | [2H][13C]([2H])([13CH3])[13C](=O)[13C](=O)[O-].[Na+] |
Computed by PubChem (NCBI)