CAS 1189500-69-3 appears in our catalog under these names: alpha-Ketobutyric Acid-13C,d2 Sodium Salt, Sodium 2-oxobutanoate-13C,d2. Offered by: TRC, MedChemExpress. Available pack sizes: 25mg, 10 mg, 25 mg, 50 mg.
Sodium 3,3-dideuterio-2-oxo(413C)butanoate (CAS 1189500-69-3) is a chemical compound with the molecular formula C4H5NaO3 and a molecular weight of 127.08 g/mol. IUPAC name: sodium 3,3-dideuterio-2-oxo(413C)butanoate. InChIKey: SUAMAHKUSIHRMR-ASMGDNRJSA-M.
| Molecular formula | C4H5NaO3 |
|---|---|
| Molecular weight | 127.08 g/mol |
| IUPAC name | sodium 3,3-dideuterio-2-oxo(413C)butanoate |
| InChIKey | SUAMAHKUSIHRMR-ASMGDNRJSA-M |
| SMILES | [2H]C([2H])([13CH3])C(=O)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)