CAS 100750-40-1 is the registry number for 3-Hydroxy-5-phenylpyrrole. Offered by: TRC. Available pack sizes: 10mg.
5-phenyl-1H-pyrrol-3-ol (CAS 100750-40-1) is a chemical compound with the molecular formula C10H9NO and a molecular weight of 159.18 g/mol. IUPAC name: 5-phenyl-1H-pyrrol-3-ol. InChIKey: BMJFHUYFKGXBCA-UHFFFAOYSA-N.
| Molecular formula | C10H9NO |
|---|---|
| Molecular weight | 159.18 g/mol |
| IUPAC name | 5-phenyl-1H-pyrrol-3-ol |
| InChIKey | BMJFHUYFKGXBCA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CN2)O |
Computed by PubChem (NCBI)