Products 1007509-57-0
CAS 1007509-57-0 appears in our catalog under these names: Dimethyl Isophthalate-2,4,5,6-d4, 98 atom % D, min 98% Chemical Purity, Dimethyl Isophthalate-2,4,5,6-d4. Offered by: CDN, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 1 mg.
Dimethyl 2,4,5,6-tetradeuteriobenzene-1,3-dicarboxylate (CAS 1007509-57-0) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 198.21 g/mol. IUPAC name: dimethyl 2,4,5,6-tetradeuteriobenzene-1,3-dicarboxylate. InChIKey: VNGOYPQMJFJDLV-LNFUJOGGSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 198.21 g/mol |
| IUPAC name | dimethyl 2,4,5,6-tetradeuteriobenzene-1,3-dicarboxylate |
| InChIKey | VNGOYPQMJFJDLV-LNFUJOGGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)OC)[2H])C(=O)OC)[2H] |
Computed by PubChem (NCBI)