Products 1007875-19-5
CAS 1007875-19-5 appears in our catalog under these names: 2,6-Dimethylimidazo(2,1-b)thiazole-5-carboxylic acid, 98%, 2,6-Dimethylimidazo[2,1-b]thiazole-5-carboxylic acid, 98%, 98%, 2,6-Dimethylimidazo[2,1-b]thiazole-5-carboxylic acid, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
2,6-dimethylimidazo[2,1-b][1,3]thiazole-5-carboxylic acid (CAS 1007875-19-5) is a chemical compound with the molecular formula C8H8N2O2S and a molecular weight of 196.23 g/mol. IUPAC name: 2,6-dimethylimidazo[2,1-b][1,3]thiazole-5-carboxylic acid. InChIKey: JUQYMQVGKKHMJT-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O2S |
|---|---|
| Molecular weight | 196.23 g/mol |
| IUPAC name | 2,6-dimethylimidazo[2,1-b][1,3]thiazole-5-carboxylic acid |
| InChIKey | JUQYMQVGKKHMJT-UHFFFAOYSA-N |
| SMILES | CC1=CN2C(=C(N=C2S1)C)C(=O)O |
Computed by PubChem (NCBI)