CAS 1007881-21-1 appears in our catalog under these names: (2S,3R)–3–Methoxy–2–((Methoxycarbonyl)aMino)butanoic acid, N-(Methoxycarbonyl)-O-methyl-L-threonine, 98%. Offered by: GLPBio, Fluorochem. Available pack sizes: 200mg, 1g.
(2S,3R)-3-methoxy-2-(methoxycarbonylamino)butanoic acid (CAS 1007881-21-1) is a chemical compound with the molecular formula C7H13NO5 and a molecular weight of 191.18 g/mol. IUPAC name: (2S,3R)-3-methoxy-2-(methoxycarbonylamino)butanoic acid. InChIKey: PAISMPKJXOZRKI-UHNVWZDZSA-N.
| Molecular formula | C7H13NO5 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | (2S,3R)-3-methoxy-2-(methoxycarbonylamino)butanoic acid |
| InChIKey | PAISMPKJXOZRKI-UHNVWZDZSA-N |
| SMILES | C[C@H]([C@@H](C(=O)O)NC(=O)OC)OC |
Computed by PubChem (NCBI)