Products 1248069-38-6

CAS 1248069-38-6 appears in our catalog under these names: {(2-(2-methoxyethoxy)ethyl)carbamoyl}formic acid, 95%, {(2-(2-Methoxyethoxy)ethyl)carbamoyl}formic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.

2-[2-(2-methoxyethoxy)ethylamino]-2-oxoacetic acid (CAS 1248069-38-6) is a chemical compound with the molecular formula C7H13NO5 and a molecular weight of 191.18 g/mol. IUPAC name: 2-[2-(2-methoxyethoxy)ethylamino]-2-oxoacetic acid. InChIKey: GAPMDAMWFPANIM-UHFFFAOYSA-N.

Identity
Molecular formulaC7H13NO5
Molecular weight191.18 g/mol
IUPAC name2-[2-(2-methoxyethoxy)ethylamino]-2-oxoacetic acid
InChIKeyGAPMDAMWFPANIM-UHFFFAOYSA-N
SMILESCOCCOCCNC(=O)C(=O)O

Computed by PubChem (NCBI)