CAS 2470438-71-0 is the registry number for 1-(2-Aminoethyl)cyclopropan-1-ol oxalate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
1-(2-aminoethyl)cyclopropan-1-ol;oxalic acid (CAS 2470438-71-0) is a chemical compound with the molecular formula C7H13NO5 and a molecular weight of 191.18 g/mol. IUPAC name: 1-(2-aminoethyl)cyclopropan-1-ol;oxalic acid. InChIKey: GMNHCEXSALIIBQ-UHFFFAOYSA-N.
| Molecular formula | C7H13NO5 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | 1-(2-aminoethyl)cyclopropan-1-ol;oxalic acid |
| InChIKey | GMNHCEXSALIIBQ-UHFFFAOYSA-N |
| SMILES | C1CC1(CCN)O.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)