CAS 100829-65-0 is the registry number for 1,1'-(Methylenedi-4,1-phenylene)bishydrazine Dihydrochloride. Offered by: TRC. Available pack sizes: 100mg.
[4-[(4-hydrazinylphenyl)methyl]phenyl]hydrazine;dihydrochloride (CAS 100829-65-0) is a chemical compound with the molecular formula C13H18Cl2N4 and a molecular weight of 301.21 g/mol. IUPAC name: [4-[(4-hydrazinylphenyl)methyl]phenyl]hydrazine;dihydrochloride. InChIKey: OMAUTLQKLYAIOO-UHFFFAOYSA-N.
| Molecular formula | C13H18Cl2N4 |
|---|---|
| Molecular weight | 301.21 g/mol |
| IUPAC name | [4-[(4-hydrazinylphenyl)methyl]phenyl]hydrazine;dihydrochloride |
| InChIKey | OMAUTLQKLYAIOO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC2=CC=C(C=C2)NN)NN.Cl.Cl |
Computed by PubChem (NCBI)