CAS 1439894-57-1 appears in our catalog under these names: (3S)-1-(Quinazolin-4-yl)piperidin-3-amine dihydrochloride, 95%, (S)-1-(Quinazolin-4-yl)piperidin-3-amine dihydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
(3S)-1-quinazolin-4-ylpiperidin-3-amine;dihydrochloride (CAS 1439894-57-1) is a chemical compound with the molecular formula C13H18Cl2N4 and a molecular weight of 301.21 g/mol. IUPAC name: (3S)-1-quinazolin-4-ylpiperidin-3-amine;dihydrochloride. InChIKey: RPMXJWIHQLPUAC-XRIOVQLTSA-N.
| Molecular formula | C13H18Cl2N4 |
|---|---|
| Molecular weight | 301.21 g/mol |
| IUPAC name | (3S)-1-quinazolin-4-ylpiperidin-3-amine;dihydrochloride |
| InChIKey | RPMXJWIHQLPUAC-XRIOVQLTSA-N |
| SMILES | C1C[C@@H](CN(C1)C2=NC=NC3=CC=CC=C32)N.Cl.Cl |
Computed by PubChem (NCBI)