CAS 1461713-40-5 appears in our catalog under these names: 3-(3-Phenyl-1H-1,2,4-triazol-5-yl)piperidine dihydrochloride, 95%, 3-(3-Phenyl-1H-1,2,4-triazol-5-yl)piperidine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-(3-phenyl-1H-1,2,4-triazol-5-yl)piperidine;dihydrochloride (CAS 1461713-40-5) is a chemical compound with the molecular formula C13H18Cl2N4 and a molecular weight of 301.21 g/mol. IUPAC name: 3-(3-phenyl-1H-1,2,4-triazol-5-yl)piperidine;dihydrochloride. InChIKey: RNOHROWMUYNBHT-UHFFFAOYSA-N.
| Molecular formula | C13H18Cl2N4 |
|---|---|
| Molecular weight | 301.21 g/mol |
| IUPAC name | 3-(3-phenyl-1H-1,2,4-triazol-5-yl)piperidine;dihydrochloride |
| InChIKey | RNOHROWMUYNBHT-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)C2=NC(=NN2)C3=CC=CC=C3.Cl.Cl |
Computed by PubChem (NCBI)