CAS 100838-77-5 is the registry number for (S)-[4,4'-Biphenanthrene]-3,3'-diol 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
4-(3-hydroxyphenanthren-4-yl)phenanthren-3-ol (CAS 100838-77-5) is a chemical compound with the molecular formula C28H18O2 and a molecular weight of 386.4 g/mol. IUPAC name: 4-(3-hydroxyphenanthren-4-yl)phenanthren-3-ol. InChIKey: NBWRXHUVCCXVBP-UHFFFAOYSA-N.
| Molecular formula | C28H18O2 |
|---|---|
| Molecular weight | 386.4 g/mol |
| IUPAC name | 4-(3-hydroxyphenanthren-4-yl)phenanthren-3-ol |
| InChIKey | NBWRXHUVCCXVBP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2C(=C(C=C3)O)C4=C(C=CC5=C4C6=CC=CC=C6C=C5)O |
Computed by PubChem (NCBI)