CAS 434-84-4 appears in our catalog under these names: Bianthronyl, 95%, (9,9'-Bianthracene)-10,10'(9H,9'H)-dione, 97%, Bianthronyl, Bianthronyl, >97.0%(HPLC), [9,9'-Bianthracene]-10,10'(9H,9'H)-dione, 97%+,RG, 97%+,RG. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 1g, 5g, 250mg, 200mg, 100mg.
10-(10-oxo-9H-anthracen-9-yl)-10H-anthracen-9-one (CAS 434-84-4) is a chemical compound with the molecular formula C28H18O2 and a molecular weight of 386.4 g/mol. IUPAC name: 10-(10-oxo-9H-anthracen-9-yl)-10H-anthracen-9-one. InChIKey: ZQXZUOJNJXNUEO-UHFFFAOYSA-N.
| Molecular formula | C28H18O2 |
|---|---|
| Molecular weight | 386.4 g/mol |
| IUPAC name | 10-(10-oxo-9H-anthracen-9-yl)-10H-anthracen-9-one |
| InChIKey | ZQXZUOJNJXNUEO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C3C2=O)C4C5=CC=CC=C5C(=O)C6=CC=CC=C46 |
Computed by PubChem (NCBI)