CAS 1176-09-6 appears in our catalog under these names: Raptinal, 95%, Raptinal/ min. 98%, Raptinal, Raptinal, >96.0%(HPLC), Raptinal 97%. Offered by: Combi-blocks, TargetMol, GLPBio, TCI, Chemat. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 250mg, 25 mg.
9-(9-formylfluoren-9-yl)fluorene-9-carbaldehyde (CAS 1176-09-6) is a chemical compound with the molecular formula C28H18O2 and a molecular weight of 386.4 g/mol. IUPAC name: 9-(9-formylfluoren-9-yl)fluorene-9-carbaldehyde. InChIKey: GLANOOJJBKXTMI-UHFFFAOYSA-N.
| Molecular formula | C28H18O2 |
|---|---|
| Molecular weight | 386.4 g/mol |
| IUPAC name | 9-(9-formylfluoren-9-yl)fluorene-9-carbaldehyde |
| InChIKey | GLANOOJJBKXTMI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3C2(C=O)C4(C5=CC=CC=C5C6=CC=CC=C64)C=O |
Computed by PubChem (NCBI)