CAS 100866-11-3 is the registry number for 5-(Naphthalen-1-yl)-3,4-dihydro-2H-pyrrole, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
5-naphthalen-1-yl-3,4-dihydro-2H-pyrrole (CAS 100866-11-3) is a chemical compound with the molecular formula C14H13N and a molecular weight of 195.26 g/mol. IUPAC name: 5-naphthalen-1-yl-3,4-dihydro-2H-pyrrole. InChIKey: RPZXBQZZNCVHPQ-UHFFFAOYSA-N.
| Molecular formula | C14H13N |
|---|---|
| Molecular weight | 195.26 g/mol |
| IUPAC name | 5-naphthalen-1-yl-3,4-dihydro-2H-pyrrole |
| InChIKey | RPZXBQZZNCVHPQ-UHFFFAOYSA-N |
| SMILES | C1CC(=NC1)C2=CC=CC3=CC=CC=C32 |
Computed by PubChem (NCBI)