CAS 27652-35-3 is the registry number for (E)-2- styrylbenzenamine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g.
2-[(E)-2-phenylethenyl]aniline (CAS 27652-35-3) is a chemical compound with the molecular formula C14H13N and a molecular weight of 195.26 g/mol. IUPAC name: 2-[(E)-2-phenylethenyl]aniline. InChIKey: BIEFDNUEROKZRA-ZHACJKMWSA-N.
| Molecular formula | C14H13N |
|---|---|
| Molecular weight | 195.26 g/mol |
| IUPAC name | 2-[(E)-2-phenylethenyl]aniline |
| InChIKey | BIEFDNUEROKZRA-ZHACJKMWSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C2=CC=CC=C2N |
Computed by PubChem (NCBI)