CAS 18992-68-2 appears in our catalog under these names: 1,3-Dimethyl-9H-carbazole, 95-<97%, 1,3-Dimethyl-9H-carbazole, ≥97-<99%, 1,3–Dimethyl–9H–carbazole, 1,3-Dimethyl-9H-carbazole, 97%, 97%, 1,3-Dimethyl-9H-carbazole, 98%. Offered by: Hoffman Fine Chemicals, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 25g, 50g, 100g, 200g, 100mg, 250mg, 1g.
1,3-dimethyl-9H-carbazole (CAS 18992-68-2) is a chemical compound with the molecular formula C14H13N and a molecular weight of 195.26 g/mol. IUPAC name: 1,3-dimethyl-9H-carbazole. InChIKey: HIVRNXYEWIPOMU-UHFFFAOYSA-N.
| Molecular formula | C14H13N |
|---|---|
| Molecular weight | 195.26 g/mol |
| IUPAC name | 1,3-dimethyl-9H-carbazole |
| InChIKey | HIVRNXYEWIPOMU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)C3=CC=CC=C3N2)C |
Computed by PubChem (NCBI)