Products 1008692-77-0
CAS 1008692-77-0 is the registry number for 1-(3-Bromobenzoyl)piperidine-2-carboxamide. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
1-(3-bromobenzoyl)piperidine-2-carboxamide (CAS 1008692-77-0) is a chemical compound with the molecular formula C13H15BrN2O2 and a molecular weight of 311.17 g/mol. IUPAC name: 1-(3-bromobenzoyl)piperidine-2-carboxamide. InChIKey: JKYRNWATFUDROK-UHFFFAOYSA-N.
| Molecular formula | C13H15BrN2O2 |
|---|---|
| Molecular weight | 311.17 g/mol |
| IUPAC name | 1-(3-bromobenzoyl)piperidine-2-carboxamide |
| InChIKey | JKYRNWATFUDROK-UHFFFAOYSA-N |
| SMILES | C1CCN(C(C1)C(=O)N)C(=O)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)