Products 2340293-48-1
CAS 2340293-48-1 is the registry number for tert-Butyl 2-(6-bromo-1h-pyrrolo[3,2-b]pyridin-1-yl)acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Tert-butyl 2-(6-bromopyrrolo[3,2-b]pyridin-1-yl)acetate (CAS 2340293-48-1) is a chemical compound with the molecular formula C13H15BrN2O2 and a molecular weight of 311.17 g/mol. IUPAC name: tert-butyl 2-(6-bromopyrrolo[3,2-b]pyridin-1-yl)acetate. InChIKey: IIHONTQNUOYEJZ-UHFFFAOYSA-N.
| Molecular formula | C13H15BrN2O2 |
|---|---|
| Molecular weight | 311.17 g/mol |
| IUPAC name | tert-butyl 2-(6-bromopyrrolo[3,2-b]pyridin-1-yl)acetate |
| InChIKey | IIHONTQNUOYEJZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CN1C=CC2=C1C=C(C=N2)Br |
Computed by PubChem (NCBI)