CAS 926922-41-0 is the registry number for tert-Butyl 4-bromo-5-methyl-1h-indazole-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
Tert-butyl 4-bromo-5-methylindazole-1-carboxylate (CAS 926922-41-0) is a chemical compound with the molecular formula C13H15BrN2O2 and a molecular weight of 311.17 g/mol. IUPAC name: tert-butyl 4-bromo-5-methylindazole-1-carboxylate. InChIKey: GQRYROVGFBSASA-UHFFFAOYSA-N.
| Molecular formula | C13H15BrN2O2 |
|---|---|
| Molecular weight | 311.17 g/mol |
| IUPAC name | tert-butyl 4-bromo-5-methylindazole-1-carboxylate |
| InChIKey | GQRYROVGFBSASA-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)N(N=C2)C(=O)OC(C)(C)C)Br |
Computed by PubChem (NCBI)