CAS 1008697-93-5 appears in our catalog under these names: 2-(4-Chloro-benzoylamino)-4-methyl-pentanoic acid, 95%, 2-((4-Chlorophenyl)formamido)-4-methylpentanoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
2-[(4-chlorobenzoyl)amino]-4-methylpentanoic acid (CAS 1008697-93-5) is a chemical compound with the molecular formula C13H16ClNO3 and a molecular weight of 269.72 g/mol. IUPAC name: 2-[(4-chlorobenzoyl)amino]-4-methylpentanoic acid. InChIKey: GBFHNWPMWRSODC-UHFFFAOYSA-N.
| Molecular formula | C13H16ClNO3 |
|---|---|
| Molecular weight | 269.72 g/mol |
| IUPAC name | 2-[(4-chlorobenzoyl)amino]-4-methylpentanoic acid |
| InChIKey | GBFHNWPMWRSODC-UHFFFAOYSA-N |
| SMILES | CC(C)CC(C(=O)O)NC(=O)C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)