Products 858018-77-6
CAS 858018-77-6 is the registry number for 1-benzyl-4-oxopiperidine-3-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-benzyl-4-oxopiperidine-3-carboxylic acid;hydrochloride (CAS 858018-77-6) is a chemical compound with the molecular formula C13H16ClNO3 and a molecular weight of 269.72 g/mol. IUPAC name: 1-benzyl-4-oxopiperidine-3-carboxylic acid;hydrochloride. InChIKey: FPMJVIHRMBCIGS-UHFFFAOYSA-N.
| Molecular formula | C13H16ClNO3 |
|---|---|
| Molecular weight | 269.72 g/mol |
| IUPAC name | 1-benzyl-4-oxopiperidine-3-carboxylic acid;hydrochloride |
| InChIKey | FPMJVIHRMBCIGS-UHFFFAOYSA-N |
| SMILES | C1CN(CC(C1=O)C(=O)O)CC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)