CAS 1189985-17-8 appears in our catalog under these names: 6-Hydroxyspiro[chroman-2,4'-piperidin]-4-one hydrochloride, 95%, 6-Hydroxyspiro(chroman-2,4'-piperidin)-4-one hydrochloride, 95%, 6–HYDROXYSPIRO(CHROMAN–2,4'–PIPERIDIN)–4–ONE HCL. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 250mg, 5g.
6-hydroxyspiro[3H-chromene-2,4'-piperidine]-4-one;hydrochloride (CAS 1189985-17-8) is a chemical compound with the molecular formula C13H16ClNO3 and a molecular weight of 269.72 g/mol. IUPAC name: 6-hydroxyspiro[3H-chromene-2,4'-piperidine]-4-one;hydrochloride. InChIKey: WJUGAYAKLNBLGX-UHFFFAOYSA-N.
| Molecular formula | C13H16ClNO3 |
|---|---|
| Molecular weight | 269.72 g/mol |
| IUPAC name | 6-hydroxyspiro[3H-chromene-2,4'-piperidine]-4-one;hydrochloride |
| InChIKey | WJUGAYAKLNBLGX-UHFFFAOYSA-N |
| SMILES | C1CNCCC12CC(=O)C3=C(O2)C=CC(=C3)O.Cl |
Computed by PubChem (NCBI)