Products 1008769-62-7

CAS 1008769-62-7 is the registry number for 4-(2-Methylpropoxy)-3-(trifluoromethyl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

4-(2-methylpropoxy)-3-(trifluoromethyl)benzoic acid (CAS 1008769-62-7) is a chemical compound with the molecular formula C12H13F3O3 and a molecular weight of 262.22 g/mol. IUPAC name: 4-(2-methylpropoxy)-3-(trifluoromethyl)benzoic acid. InChIKey: DSGIPYFLOPVIAP-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13F3O3
Molecular weight262.22 g/mol
IUPAC name4-(2-methylpropoxy)-3-(trifluoromethyl)benzoic acid
InChIKeyDSGIPYFLOPVIAP-UHFFFAOYSA-N
SMILESCC(C)COC1=C(C=C(C=C1)C(=O)O)C(F)(F)F

Computed by PubChem (NCBI)