Products 2307299-94-9

CAS 2307299-94-9 is the registry number for 2-Methyl-3-(3-(2,2,2-trifluoroethoxy)phenyl)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

2-methyl-3-[3-(2,2,2-trifluoroethoxy)phenyl]propanoic acid (CAS 2307299-94-9) is a chemical compound with the molecular formula C12H13F3O3 and a molecular weight of 262.22 g/mol. IUPAC name: 2-methyl-3-[3-(2,2,2-trifluoroethoxy)phenyl]propanoic acid. InChIKey: GVSNNWPVMZSRPA-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13F3O3
Molecular weight262.22 g/mol
IUPAC name2-methyl-3-[3-(2,2,2-trifluoroethoxy)phenyl]propanoic acid
InChIKeyGVSNNWPVMZSRPA-UHFFFAOYSA-N
SMILESCC(CC1=CC(=CC=C1)OCC(F)(F)F)C(=O)O

Computed by PubChem (NCBI)