Products 1892331-33-7

CAS 1892331-33-7 is the registry number for 3-(2-Methoxy-4-trifluoromethyl-phenyl)-2-methyl-propionic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

3-[2-methoxy-4-(trifluoromethyl)phenyl]-2-methylpropanoic acid (CAS 1892331-33-7) is a chemical compound with the molecular formula C12H13F3O3 and a molecular weight of 262.22 g/mol. IUPAC name: 3-[2-methoxy-4-(trifluoromethyl)phenyl]-2-methylpropanoic acid. InChIKey: HLCJPLJVUAEUMH-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13F3O3
Molecular weight262.22 g/mol
IUPAC name3-[2-methoxy-4-(trifluoromethyl)phenyl]-2-methylpropanoic acid
InChIKeyHLCJPLJVUAEUMH-UHFFFAOYSA-N
SMILESCC(CC1=C(C=C(C=C1)C(F)(F)F)OC)C(=O)O

Computed by PubChem (NCBI)