CAS 1008796-22-2 appears in our catalog under these names: 9-(Benzyloxy)-3-(2-hydroxyethyl)-2-methyl-4H-pyrido(1,2-a)pyrimidin-4-one, 9-(Benzyloxy)-3-(2-hydroxyethyl)-2-methyl-4H-pyrido[1,2-a]pyrimidin-4-one, 97%, 9-(Benzyloxy)-3-(2-hydroxyethyl)-2-methyl-4H-pyrido[1,2-a]pyrimidin-4-one, 97%, 97%, Paliperidone impurity 1, 97.49%, Paliperidone impurity 1 (Standard). Offered by: TRC, Fluorochem, Chemat, MedChemExpress. Available pack sizes: 1g, 100mg, 250mg, 100 mg, 500 mg, 250 mg, 1 g, 50 mg.
3-(2-hydroxyethyl)-2-methyl-9-phenylmethoxypyrido[1,2-a]pyrimidin-4-one (CAS 1008796-22-2) is a chemical compound with the molecular formula C18H18N2O3 and a molecular weight of 310.3 g/mol. IUPAC name: 3-(2-hydroxyethyl)-2-methyl-9-phenylmethoxypyrido[1,2-a]pyrimidin-4-one. InChIKey: AYNDDJMEHBUOGI-UHFFFAOYSA-N.
| Molecular formula | C18H18N2O3 |
|---|---|
| Molecular weight | 310.3 g/mol |
| IUPAC name | 3-(2-hydroxyethyl)-2-methyl-9-phenylmethoxypyrido[1,2-a]pyrimidin-4-one |
| InChIKey | AYNDDJMEHBUOGI-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N2C=CC=C(C2=N1)OCC3=CC=CC=C3)CCO |
Computed by PubChem (NCBI)