CAS 1008956-66-8 is the registry number for 4–Methyl–2–(4–(2–methylphenoxy)benzenesulfonamido)pentanoic acid. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
4-methyl-2-[[4-(2-methylphenoxy)phenyl]sulfonylamino]pentanoic acid (CAS 1008956-66-8) is a chemical compound with the molecular formula C19H23NO5S and a molecular weight of 377.5 g/mol. IUPAC name: 4-methyl-2-[[4-(2-methylphenoxy)phenyl]sulfonylamino]pentanoic acid. InChIKey: DDTGJTCEKLOLRD-UHFFFAOYSA-N.
| Molecular formula | C19H23NO5S |
|---|---|
| Molecular weight | 377.5 g/mol |
| IUPAC name | 4-methyl-2-[[4-(2-methylphenoxy)phenyl]sulfonylamino]pentanoic acid |
| InChIKey | DDTGJTCEKLOLRD-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1OC2=CC=C(C=C2)S(=O)(=O)NC(CC(C)C)C(=O)O |
Computed by PubChem (NCBI)