CAS 741259-87-0 is the registry number for N-Boc-alpha-(phenylsulfonyl)-4-methoxybenzylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g.
Tert-butyl N-[benzenesulfonyl-(4-methoxyphenyl)methyl]carbamate (CAS 741259-87-0) is a chemical compound with the molecular formula C19H23NO5S and a molecular weight of 377.5 g/mol. IUPAC name: tert-butyl N-[benzenesulfonyl-(4-methoxyphenyl)methyl]carbamate. InChIKey: JBOXLVHIHXWCPQ-UHFFFAOYSA-N.
| Molecular formula | C19H23NO5S |
|---|---|
| Molecular weight | 377.5 g/mol |
| IUPAC name | tert-butyl N-[benzenesulfonyl-(4-methoxyphenyl)methyl]carbamate |
| InChIKey | JBOXLVHIHXWCPQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C1=CC=C(C=C1)OC)S(=O)(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)