CAS 125483-57-0 appears in our catalog under these names: Benzyl 1–aminocyclobutanecarboxylate 4–methylbenzenesulfonate, Benzyl 1-aminocyclobutanecarboxylate 4-methylbenzenesulfonate, 95%. Offered by: GLPBio, Fluorochem. Available pack sizes: 1g, 5g.
Benzyl 1-aminocyclobutane-1-carboxylate;4-methylbenzenesulfonic acid (CAS 125483-57-0) is a chemical compound with the molecular formula C19H23NO5S and a molecular weight of 377.5 g/mol. IUPAC name: benzyl 1-aminocyclobutane-1-carboxylate;4-methylbenzenesulfonic acid. InChIKey: VMURDJGCQYSKKE-UHFFFAOYSA-N.
| Molecular formula | C19H23NO5S |
|---|---|
| Molecular weight | 377.5 g/mol |
| IUPAC name | benzyl 1-aminocyclobutane-1-carboxylate;4-methylbenzenesulfonic acid |
| InChIKey | VMURDJGCQYSKKE-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.C1CC(C1)(C(=O)OCC2=CC=CC=C2)N |
Computed by PubChem (NCBI)