Products 100905-61-1
CAS 100905-61-1 is the registry number for (E)-2-(2-(Bromomethyl)-3-fluoroallyl)isoindoline-1,3-dione, 98%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-[(E)-2-(bromomethyl)-3-fluoroprop-2-enyl]isoindole-1,3-dione (CAS 100905-61-1) is a chemical compound with the molecular formula C12H9BrFNO2 and a molecular weight of 298.11 g/mol. IUPAC name: 2-[(E)-2-(bromomethyl)-3-fluoroprop-2-enyl]isoindole-1,3-dione. InChIKey: PGDVRQPWRWDSGX-VURMDHGXSA-N.
| Molecular formula | C12H9BrFNO2 |
|---|---|
| Molecular weight | 298.11 g/mol |
| IUPAC name | 2-[(E)-2-(bromomethyl)-3-fluoroprop-2-enyl]isoindole-1,3-dione |
| InChIKey | PGDVRQPWRWDSGX-VURMDHGXSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)C/C(=C\F)/CBr |
Computed by PubChem (NCBI)