CAS 100914-36-1 is the registry number for 6,3'-Dinitroflavone. Offered by: Chemat Brand. Available pack sizes: on request.
6-nitro-2-(3-nitrophenyl)chromen-4-one (CAS 100914-36-1) is a chemical compound with the molecular formula C15H8N2O6 and a molecular weight of 312.23 g/mol. IUPAC name: 6-nitro-2-(3-nitrophenyl)chromen-4-one. InChIKey: CNVQMRWAJHEFGZ-UHFFFAOYSA-N.
| Molecular formula | C15H8N2O6 |
|---|---|
| Molecular weight | 312.23 g/mol |
| IUPAC name | 6-nitro-2-(3-nitrophenyl)chromen-4-one |
| InChIKey | CNVQMRWAJHEFGZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C2=CC(=O)C3=C(O2)C=CC(=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)