Products 98704-22-4

CAS 98704-22-4 is the registry number for AChE-IN-65, 99.37%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 10 mg, 10mM/1mL, 5 mg.

Structural formula: {0} (CAS {1})

3,5-bis(2,5-dioxopyrrol-1-yl)benzoic acid (CAS 98704-22-4) is a chemical compound with the molecular formula C15H8N2O6 and a molecular weight of 312.23 g/mol. IUPAC name: 3,5-bis(2,5-dioxopyrrol-1-yl)benzoic acid. InChIKey: RCBGGBMZYJSLJE-UHFFFAOYSA-N.

Identity
Molecular formulaC15H8N2O6
Molecular weight312.23 g/mol
IUPAC name3,5-bis(2,5-dioxopyrrol-1-yl)benzoic acid
InChIKeyRCBGGBMZYJSLJE-UHFFFAOYSA-N
SMILESC1=CC(=O)N(C1=O)C2=CC(=CC(=C2)C(=O)O)N3C(=O)C=CC3=O

Computed by PubChem (NCBI)