CAS 110768-20-2 is the registry number for 2-(4-Nitrophenyl)-1,3-dioxoisoindoline-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(4-nitrophenyl)-1,3-dioxoisoindole-5-carboxylic acid (CAS 110768-20-2) is a chemical compound with the molecular formula C15H8N2O6 and a molecular weight of 312.23 g/mol. IUPAC name: 2-(4-nitrophenyl)-1,3-dioxoisoindole-5-carboxylic acid. InChIKey: ZQQMHXVUPKKVJQ-UHFFFAOYSA-N.
| Molecular formula | C15H8N2O6 |
|---|---|
| Molecular weight | 312.23 g/mol |
| IUPAC name | 2-(4-nitrophenyl)-1,3-dioxoisoindole-5-carboxylic acid |
| InChIKey | ZQQMHXVUPKKVJQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C(=O)C3=C(C2=O)C=C(C=C3)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)