Products 110768-20-2

CAS 110768-20-2 is the registry number for 2-(4-Nitrophenyl)-1,3-dioxoisoindoline-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(4-nitrophenyl)-1,3-dioxoisoindole-5-carboxylic acid (CAS 110768-20-2) is a chemical compound with the molecular formula C15H8N2O6 and a molecular weight of 312.23 g/mol. IUPAC name: 2-(4-nitrophenyl)-1,3-dioxoisoindole-5-carboxylic acid. InChIKey: ZQQMHXVUPKKVJQ-UHFFFAOYSA-N.

Identity
Molecular formulaC15H8N2O6
Molecular weight312.23 g/mol
IUPAC name2-(4-nitrophenyl)-1,3-dioxoisoindole-5-carboxylic acid
InChIKeyZQQMHXVUPKKVJQ-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1N2C(=O)C3=C(C2=O)C=C(C=C3)C(=O)O)[N+](=O)[O-]

Computed by PubChem (NCBI)