Products 1009376-62-8
CAS 1009376-62-8 is the registry number for methyl (3R,4S)-4-methylpiperidine-3-carboxylate,hydrochloride, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl (3R,4S)-4-methylpiperidine-3-carboxylate (CAS 1009376-62-8) is a chemical compound with the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. IUPAC name: methyl (3R,4S)-4-methylpiperidine-3-carboxylate. InChIKey: OGSFGBNZYUWVFP-BQBZGAKWSA-N.
| Molecular formula | C8H15NO2 |
|---|---|
| Molecular weight | 157.21 g/mol |
| IUPAC name | methyl (3R,4S)-4-methylpiperidine-3-carboxylate |
| InChIKey | OGSFGBNZYUWVFP-BQBZGAKWSA-N |
| SMILES | C[C@H]1CCNC[C@@H]1C(=O)OC |
Computed by PubChem (NCBI)