CAS 100940-00-9 is the registry number for (3-Chlorophenyl)(piperazin-1-yl)methanone hydrochloride, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(3-chlorophenyl)-piperazin-1-ylmethanone;hydrochloride (CAS 100940-00-9) is a chemical compound with the molecular formula C11H14Cl2N2O and a molecular weight of 261.14 g/mol. IUPAC name: (3-chlorophenyl)-piperazin-1-ylmethanone;hydrochloride. InChIKey: CMPRJMOPQJCQSW-UHFFFAOYSA-N.
| Molecular formula | C11H14Cl2N2O |
|---|---|
| Molecular weight | 261.14 g/mol |
| IUPAC name | (3-chlorophenyl)-piperazin-1-ylmethanone;hydrochloride |
| InChIKey | CMPRJMOPQJCQSW-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C(=O)C2=CC(=CC=C2)Cl.Cl |
Computed by PubChem (NCBI)