Products 2414674-71-6
CAS 2414674-71-6 appears in our catalog under these names: suvn-911, SUVN–911, SUVN-911, 99.13%, SUVN-911, 99%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso).
(1R,3S,5R)-3-[(6-chloro-3-pyridinyl)oxymethyl]-2-azabicyclo[3.1.0]hexane;hydrochloride (CAS 2414674-71-6) is a chemical compound with the molecular formula C11H14Cl2N2O and a molecular weight of 261.14 g/mol. IUPAC name: (1R,3S,5R)-3-[(6-chloro-3-pyridinyl)oxymethyl]-2-azabicyclo[3.1.0]hexane;hydrochloride. InChIKey: VZIQKVIAFWXNFL-ANYFZDTESA-N.
| Molecular formula | C11H14Cl2N2O |
|---|---|
| Molecular weight | 261.14 g/mol |
| IUPAC name | (1R,3S,5R)-3-[(6-chloro-3-pyridinyl)oxymethyl]-2-azabicyclo[3.1.0]hexane;hydrochloride |
| InChIKey | VZIQKVIAFWXNFL-ANYFZDTESA-N |
| SMILES | C1[C@H]2C[C@H]2N[C@@H]1COC3=CN=C(C=C3)Cl.Cl |
Computed by PubChem (NCBI)