CAS 57238-82-1 appears in our catalog under these names: 1-(2-Chlorobenzoyl)piperazine hydrochloride, 95%, (2–Chlorophenyl)–1–piperazinyl–methanone hydrochloride, (2-Chlorophenyl)-1-piperazinyl-methanone hydrochloride, (2-Chlorophenyl)-1-piperazinyl-methanone hydrochloride, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg.
(2-chlorophenyl)-piperazin-1-ylmethanone;hydrochloride (CAS 57238-82-1) is a chemical compound with the molecular formula C11H14Cl2N2O and a molecular weight of 261.14 g/mol. IUPAC name: (2-chlorophenyl)-piperazin-1-ylmethanone;hydrochloride. InChIKey: DNSJPAKXQUGKEV-UHFFFAOYSA-N.
| Molecular formula | C11H14Cl2N2O |
|---|---|
| Molecular weight | 261.14 g/mol |
| IUPAC name | (2-chlorophenyl)-piperazin-1-ylmethanone;hydrochloride |
| InChIKey | DNSJPAKXQUGKEV-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C(=O)C2=CC=CC=C2Cl.Cl |
Computed by PubChem (NCBI)