CAS 1009519-24-7 is the registry number for 1-((4-Fluorophenyl)carbamoyl)pyrrolidine-2-carboxylic acid, 98%. Offered by: AmBeed. Available pack sizes: 5g.
1-[(4-fluorophenyl)carbamoyl]pyrrolidine-2-carboxylic acid (CAS 1009519-24-7) is a chemical compound with the molecular formula C12H13FN2O3 and a molecular weight of 252.24 g/mol. IUPAC name: 1-[(4-fluorophenyl)carbamoyl]pyrrolidine-2-carboxylic acid. InChIKey: CYVTYTNYTQOEDD-UHFFFAOYSA-N.
| Molecular formula | C12H13FN2O3 |
|---|---|
| Molecular weight | 252.24 g/mol |
| IUPAC name | 1-[(4-fluorophenyl)carbamoyl]pyrrolidine-2-carboxylic acid |
| InChIKey | CYVTYTNYTQOEDD-UHFFFAOYSA-N |
| SMILES | C1CC(N(C1)C(=O)NC2=CC=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)