CAS 2589533-22-0 is the registry number for Methyl 2-ethyl-7-fluoro-3-oxo-1,2,3,4-tetrahydroquinoxaline-6-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-ethyl-7-fluoro-3-oxo-2,4-dihydro-1H-quinoxaline-6-carboxylate (CAS 2589533-22-0) is a chemical compound with the molecular formula C12H13FN2O3 and a molecular weight of 252.24 g/mol. IUPAC name: methyl 2-ethyl-7-fluoro-3-oxo-2,4-dihydro-1H-quinoxaline-6-carboxylate. InChIKey: IZQKMVYIJXQFPB-UHFFFAOYSA-N.
| Molecular formula | C12H13FN2O3 |
|---|---|
| Molecular weight | 252.24 g/mol |
| IUPAC name | methyl 2-ethyl-7-fluoro-3-oxo-2,4-dihydro-1H-quinoxaline-6-carboxylate |
| InChIKey | IZQKMVYIJXQFPB-UHFFFAOYSA-N |
| SMILES | CCC1C(=O)NC2=C(N1)C=C(C(=C2)C(=O)OC)F |
Computed by PubChem (NCBI)