CAS 1240747-72-1 is the registry number for 2-(Cyclopropylamino)-2-oxoethyl 2-amino-4-fluorobenzoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[2-(cyclopropylamino)-2-oxoethyl] 2-amino-4-fluorobenzoate (CAS 1240747-72-1) is a chemical compound with the molecular formula C12H13FN2O3 and a molecular weight of 252.24 g/mol. IUPAC name: [2-(cyclopropylamino)-2-oxoethyl] 2-amino-4-fluorobenzoate. InChIKey: QYCIFOTUMVFGCK-UHFFFAOYSA-N.
| Molecular formula | C12H13FN2O3 |
|---|---|
| Molecular weight | 252.24 g/mol |
| IUPAC name | [2-(cyclopropylamino)-2-oxoethyl] 2-amino-4-fluorobenzoate |
| InChIKey | QYCIFOTUMVFGCK-UHFFFAOYSA-N |
| SMILES | C1CC1NC(=O)COC(=O)C2=C(C=C(C=C2)F)N |
Computed by PubChem (NCBI)