Products 1240747-72-1

CAS 1240747-72-1 is the registry number for 2-(Cyclopropylamino)-2-oxoethyl 2-amino-4-fluorobenzoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

[2-(cyclopropylamino)-2-oxoethyl] 2-amino-4-fluorobenzoate (CAS 1240747-72-1) is a chemical compound with the molecular formula C12H13FN2O3 and a molecular weight of 252.24 g/mol. IUPAC name: [2-(cyclopropylamino)-2-oxoethyl] 2-amino-4-fluorobenzoate. InChIKey: QYCIFOTUMVFGCK-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13FN2O3
Molecular weight252.24 g/mol
IUPAC name[2-(cyclopropylamino)-2-oxoethyl] 2-amino-4-fluorobenzoate
InChIKeyQYCIFOTUMVFGCK-UHFFFAOYSA-N
SMILESC1CC1NC(=O)COC(=O)C2=C(C=C(C=C2)F)N

Computed by PubChem (NCBI)