CAS 100960-19-8 is the registry number for 7-Chloro-5-sulfamoyl Hydrochlorothiazide. Offered by: TRC. Available pack sizes: 100mg.
7-chloro-1,1-dioxo-3,4-dihydro-2H-1lambda6,2,4-benzothiadiazine-5-sulfonamide (CAS 100960-19-8) is a chemical compound with the molecular formula C7H8ClN3O4S2 and a molecular weight of 297.7 g/mol. IUPAC name: 7-chloro-1,1-dioxo-3,4-dihydro-2H-1lambda6,2,4-benzothiadiazine-5-sulfonamide. InChIKey: SNUZOFONGMKQAC-UHFFFAOYSA-N.
| Molecular formula | C7H8ClN3O4S2 |
|---|---|
| Molecular weight | 297.7 g/mol |
| IUPAC name | 7-chloro-1,1-dioxo-3,4-dihydro-2H-1lambda6,2,4-benzothiadiazine-5-sulfonamide |
| InChIKey | SNUZOFONGMKQAC-UHFFFAOYSA-N |
| SMILES | C1NC2=C(C=C(C=C2S(=O)(=O)N)Cl)S(=O)(=O)N1 |
Computed by PubChem (NCBI)